About 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride
3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride (PubChem CID 88792204) has the molecular formula C5H7ClF3NO3S
and a molecular weight of 253.63 g/mol. Its IUPAC name is 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride |
| PubChem CID | 88792204 |
| Molecular Formula | C5H7ClF3NO3S |
| Molecular Weight | 253.63 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride |
| SMILES | NC(CCS(=O)(=O)Cl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C5H7ClF3NO3S/c6-14(12,13)2-1-3(10)4(11)5(7,8)9/h3H,1-2,10H2 |
| InChIKey | SRBKKLUBLIUHMH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.63 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride?
The IUPAC name of 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride (CID 88792204) is 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride.
What is the SMILES notation for 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride?
The canonical SMILES for 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride is NC(CCS(=O)(=O)Cl)C(=O)C(F)(F)F.
What is the InChIKey of 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride?
The InChIKey is SRBKKLUBLIUHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClF3NO3S/c6-14(12,13)2-1-3(10)4(11)5(7,8)9/h3H,1-2,10H2.
What are the key properties of 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride?
3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride has a molecular weight of 253.63 g/mol, XLogP of 0.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,5,5-trifluoro-4-oxopentane-1-sulfonyl chloride is sourced from PubChem (CID 88792204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).