C2Cl2F3NO2S — CID 55279207
(1Z)-N-chlorosulfonyl-2,2,2-trifluoroethanimidoyl chloride (PubChem CID 55279207) has the molecular formula C2Cl2F3NO2S and a molecular weight of 229.99 g/mol. Its IUPAC name is (1Z)-N-chlorosulfonyl-2,2,2-trifluoroethanimidoyl chloride.
| Compound Name | (1Z)-N-chlorosulfonyl-2,2,2-trifluoroethanimidoyl chloride |
|---|---|
| PubChem CID | 55279207 |
| Molecular Formula | C2Cl2F3NO2S |
| Molecular Weight | 229.99 g/mol |
| Exact Mass | 228.90 |
| IUPAC Name | (1Z)-N-chlorosulfonyl-2,2,2-trifluoroethanimidoyl chloride |
| SMILES | O=S(=O)(Cl)/N=C(\Cl)C(F)(F)F |
| InChI | InChI=1S/C2Cl2F3NO2S/c3-1(2(5,6)7)8-11(4,9)10/b8-1- |
| InChIKey | WVDOANJONQLBET-QPIMQUGISA-N |
| XLogP | 1.67 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.99 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|