C3F6NO3S- — CID 59386224
2,2,2-trifluoro-N-(trifluoromethylsulfonyl)ethanimidate (PubChem CID 59386224) has the molecular formula C3F6NO3S- and a molecular weight of 244.09 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)ethanimidate.
| Compound Name | 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)ethanimidate |
|---|---|
| PubChem CID | 59386224 |
| Molecular Formula | C3F6NO3S- |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)ethanimidate |
| SMILES | O=S(=O)(N=C([O-])C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3HF6NO3S/c4-2(5,6)1(11)10-14(12,13)3(7,8)9/h(H,10,11)/p-1 |
| InChIKey | CFYBHDCZEADVJH-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|