C3H3F3NO3S- — CID 20807114
(1E)-N-(trifluoromethylsulfonyl)ethanimidate (PubChem CID 20807114) has the molecular formula C3H3F3NO3S- and a molecular weight of 190.12 g/mol. Its IUPAC name is (1E)-N-(trifluoromethylsulfonyl)ethanimidate.
| Compound Name | (1E)-N-(trifluoromethylsulfonyl)ethanimidate |
|---|---|
| PubChem CID | 20807114 |
| Molecular Formula | C3H3F3NO3S- |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | (1E)-N-(trifluoromethylsulfonyl)ethanimidate |
| SMILES | C/C([O-])=N\S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C3H4F3NO3S/c1-2(8)7-11(9,10)3(4,5)6/h1H3,(H,7,8)/p-1 |
| InChIKey | QMDQWTMVQROPFX-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|