C7H13F3NO3SSi- — CID 155621370
(1Z)-N-(trifluoromethylsulfonyl)-3-trimethylsilylpropanimidate (PubChem CID 155621370) has the molecular formula C7H13F3NO3SSi- and a molecular weight of 276.33 g/mol. Its IUPAC name is (1Z)-N-(trifluoromethylsulfonyl)-3-trimethylsilylpropanimidate.
| Compound Name | (1Z)-N-(trifluoromethylsulfonyl)-3-trimethylsilylpropanimidate |
|---|---|
| PubChem CID | 155621370 |
| Molecular Formula | C7H13F3NO3SSi- |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | (1Z)-N-(trifluoromethylsulfonyl)-3-trimethylsilylpropanimidate |
| SMILES | C[Si](C)(C)CC/C([O-])=N/S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H14F3NO3SSi/c1-16(2,3)5-4-6(12)11-15(13,14)7(8,9)10/h4-5H2,1-3H3,(H,11,12)/p-1 |
| InChIKey | PMCNEHGCIPQNKF-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|