C21H24F3N2O3PS — CID 177481273
(1Z)-3-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-ium-1-yl]-N-(trifluoromethylsulfonyl)propanimidate (PubChem CID 177481273) has the molecular formula C21H24F3N2O3PS and a molecular weight of 472.47 g/mol. Its IUPAC name is (1Z)-3-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-ium-1-yl]-N-(trifluoromethylsulfonyl)propanimidate.
| Compound Name | (1Z)-3-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-ium-1-yl]-N-(trifluoromethylsulfonyl)propanimidate |
|---|---|
| PubChem CID | 177481273 |
| Molecular Formula | C21H24F3N2O3PS |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (1Z)-3-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-ium-1-yl]-N-(trifluoromethylsulfonyl)propanimidate |
| SMILES | O=S(=O)(/N=C(\[O-])CC[NH+]1CCC[C@H]1CP(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H24F3N2O3PS/c22-21(23,24)31(28,29)25-20(27)13-15-26-14-7-8-17(26)16-30(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-12,17H,7-8,13-16H2,(H,25,27)/t17-/m0/s1 |
| InChIKey | HJIOLDOTJNOLCV-KRWDZBQOSA-N |
| XLogP | 1.17 |
| TPSA | 74.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|