C23H28F3N2O3PS — CID 102199811
5-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-N-(trifluoromethylsulfonyl)pentanamide (PubChem CID 102199811) has the molecular formula C23H28F3N2O3PS and a molecular weight of 500.52 g/mol. Its IUPAC name is 5-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-N-(trifluoromethylsulfonyl)pentanamide.
| Compound Name | 5-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-N-(trifluoromethylsulfonyl)pentanamide |
|---|---|
| PubChem CID | 102199811 |
| Molecular Formula | C23H28F3N2O3PS |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 5-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-N-(trifluoromethylsulfonyl)pentanamide |
| SMILES | O=C(CCCCN1CCC[C@H]1CP(c1ccccc1)c1ccccc1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H28F3N2O3PS/c24-23(25,26)33(30,31)27-22(29)15-7-8-16-28-17-9-10-19(28)18-32(20-11-3-1-4-12-20)21-13-5-2-6-14-21/h1-6,11-14,19H,7-10,15-18H2,(H,27,29)/t19-/m0/s1 |
| InChIKey | OUNMMXZFCGJGGT-IBGZPJMESA-N |
| XLogP | 3.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|