C20H24NOP — CID 15534450
1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 15534450) has the molecular formula C20H24NOP and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 15534450 |
| Molecular Formula | C20H24NOP |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24NOP/c1-2-20(22)21-15-9-10-17(21)16-23(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,17H,2,9-10,15-16H2,1H3/t17-/m0/s1 |
| InChIKey | ZXGPLZNAOXTJTA-KRWDZBQOSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|