C27H30NOPS — CID 100934790
[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-(2-propylsulfanylphenyl)methanone (PubChem CID 100934790) has the molecular formula C27H30NOPS and a molecular weight of 447.58 g/mol. Its IUPAC name is [(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-(2-propylsulfanylphenyl)methanone.
| Compound Name | [(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-(2-propylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 100934790 |
| Molecular Formula | C27H30NOPS |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-(2-propylsulfanylphenyl)methanone |
| SMILES | CCCSc1ccccc1C(=O)N1CCC[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30NOPS/c1-2-20-31-26-18-10-9-17-25(26)27(29)28-19-11-12-22(28)21-30(23-13-5-3-6-14-23)24-15-7-4-8-16-24/h3-10,13-18,22H,2,11-12,19-21H2,1H3/t22-/m0/s1 |
| InChIKey | FUMCSHMNHJFPNE-QFIPXVFZSA-N |
| XLogP | 5.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|