C14H16N2O2S — CID 66260578
2-[2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]phenyl]sulfanylacetonitrile (PubChem CID 66260578) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-[2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]phenyl]sulfanylacetonitrile.
| Compound Name | 2-[2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]phenyl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 66260578 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-[2-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]phenyl]sulfanylacetonitrile |
| SMILES | N#CCSc1ccccc1C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C14H16N2O2S/c15-7-9-19-13-6-2-1-5-12(13)14(18)16-8-3-4-11(16)10-17/h1-2,5-6,11,17H,3-4,8-10H2/t11-/m0/s1 |
| InChIKey | PMQYVECJRXUYEE-NSHDSACASA-N |
| XLogP | 1.90 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |