C15H18N2O2S — CID 102785505
2-[2-[2-(hydroxymethyl)-3-methylpyrrolidine-1-carbonyl]phenyl]sulfanylacetonitrile (PubChem CID 102785505) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-[2-[2-(hydroxymethyl)-3-methylpyrrolidine-1-carbonyl]phenyl]sulfanylacetonitrile.
| Compound Name | 2-[2-[2-(hydroxymethyl)-3-methylpyrrolidine-1-carbonyl]phenyl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 102785505 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[2-[2-(hydroxymethyl)-3-methylpyrrolidine-1-carbonyl]phenyl]sulfanylacetonitrile |
| SMILES | CC1CCN(C(=O)c2ccccc2SCC#N)C1CO |
| InChI | InChI=1S/C15H18N2O2S/c1-11-6-8-17(13(11)10-18)15(19)12-4-2-3-5-14(12)20-9-7-16/h2-5,11,13,18H,6,8-10H2,1H3 |
| InChIKey | HIKDJASKZGWVNU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |