C23H23NOP — CID 11386099
CID 11386099 (PubChem CID 11386099) has the molecular formula C23H23NOP and a molecular weight of 360.42 g/mol.
| Compound Name | CID 11386099 |
|---|---|
| PubChem CID | 11386099 |
| Molecular Formula | C23H23NOP |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | — |
| SMILES | O=C([C]1[CH][CH][CH][CH]1)N1CCC[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NOP/c25-23(19-10-7-8-11-19)24-17-9-12-20(24)18-26(21-13-3-1-4-14-21)22-15-5-2-6-16-22/h1-8,10-11,13-16,20H,9,12,17-18H2/t20-/m0/s1 |
| InChIKey | XBMNQYAQWDTDFU-FQEVSTJZSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|