C14H16F3NO — CID 176730294
phenyl-[(2S)-2-(3,3,3-trifluoropropyl)pyrrolidin-1-yl]methanone (PubChem CID 176730294) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is phenyl-[(2S)-2-(3,3,3-trifluoropropyl)pyrrolidin-1-yl]methanone.
| Compound Name | phenyl-[(2S)-2-(3,3,3-trifluoropropyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 176730294 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | phenyl-[(2S)-2-(3,3,3-trifluoropropyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCC[C@H]1CCC(F)(F)F |
| InChI | InChI=1S/C14H16F3NO/c15-14(16,17)9-8-12-7-4-10-18(12)13(19)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2/t12-/m0/s1 |
| InChIKey | ARQZGMXORBURFL-LBPRGKRZSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |