C28H35N2P — CID 101255158
(2R)-1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-N,N-dimethyl-3-phenylpropan-2-amine (PubChem CID 101255158) has the molecular formula C28H35N2P and a molecular weight of 430.58 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-N,N-dimethyl-3-phenylpropan-2-amine.
| Compound Name | (2R)-1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-N,N-dimethyl-3-phenylpropan-2-amine |
|---|---|
| PubChem CID | 101255158 |
| Molecular Formula | C28H35N2P |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (2R)-1-[(2S)-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]-N,N-dimethyl-3-phenylpropan-2-amine |
| SMILES | CN(C)[C@H](Cc1ccccc1)CN1CCC[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35N2P/c1-29(2)26(21-24-13-6-3-7-14-24)22-30-20-12-15-25(30)23-31(27-16-8-4-9-17-27)28-18-10-5-11-19-28/h3-11,13-14,16-19,25-26H,12,15,20-23H2,1-2H3/t25-,26+/m0/s1 |
| InChIKey | QKGNGRDCPIWGSU-IZZNHLLZSA-N |
| XLogP | 4.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|