C38H32F3O3P3S — CID 139119438
diphenylphosphanyl-(diphenylphosphanylmethyl)-diphenylphosphanium;trifluoromethanesulfonate (PubChem CID 139119438) has the molecular formula C38H32F3O3P3S and a molecular weight of 718.65 g/mol. Its IUPAC name is diphenylphosphanyl-(diphenylphosphanylmethyl)-diphenylphosphanium;trifluoromethanesulfonate.
| Compound Name | diphenylphosphanyl-(diphenylphosphanylmethyl)-diphenylphosphanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139119438 |
| Molecular Formula | C38H32F3O3P3S |
| Molecular Weight | 718.65 g/mol |
| Exact Mass | 718.12 |
| IUPAC Name | diphenylphosphanyl-(diphenylphosphanylmethyl)-diphenylphosphanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(P(C[P+](c2ccccc2)(c2ccccc2)P(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H32P3.CHF3O3S/c1-7-19-32(20-8-1)38(33-21-9-2-10-22-33)31-40(36-27-15-5-16-28-36,37-29-17-6-18-30-37)39(34-23-11-3-12-24-34)35-25-13-4-14-26-35;2-1(3,4)8(5,6)7/h1-30H,31H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WYAAZVMPCZNOIW-UHFFFAOYSA-M |
| XLogP | 7.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.65 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|