C29H28Li2O8P2S2 — CID 15903954
dilithium;[2,2-bis(diphenylphosphanylmethyl)-3-sulfonatooxypropyl] sulfate (PubChem CID 15903954) has the molecular formula C29H28Li2O8P2S2 and a molecular weight of 644.50 g/mol. Its IUPAC name is dilithium;[2,2-bis(diphenylphosphanylmethyl)-3-sulfonatooxypropyl] sulfate.
| Compound Name | dilithium;[2,2-bis(diphenylphosphanylmethyl)-3-sulfonatooxypropyl] sulfate |
|---|---|
| PubChem CID | 15903954 |
| Molecular Formula | C29H28Li2O8P2S2 |
| Molecular Weight | 644.50 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | dilithium;[2,2-bis(diphenylphosphanylmethyl)-3-sulfonatooxypropyl] sulfate |
| SMILES | O=S(=O)([O-])OCC(COS(=O)(=O)[O-])(CP(c1ccccc1)c1ccccc1)CP(c1ccccc1)c1ccccc1.[Li+].[Li+] |
| InChI | InChI=1S/C29H30O8P2S2.2Li/c30-40(31,32)36-21-29(22-37-41(33,34)35,23-38(25-13-5-1-6-14-25)26-15-7-2-8-16-26)24-39(27-17-9-3-10-18-27)28-19-11-4-12-20-28;;/h1-20H,21-24H2,(H,30,31,32)(H,33,34,35);;/q;2*+1/p-2 |
| InChIKey | VXCKJMZLMGMWIG-UHFFFAOYSA-L |
| XLogP | -2.80 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.50 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|