C19H16KO3PS — CID 59163443
potassium 2-(diphenylphosphanylmethyl)benzenesulfonate (PubChem CID 59163443) has the molecular formula C19H16KO3PS and a molecular weight of 394.47 g/mol. Its IUPAC name is potassium 2-(diphenylphosphanylmethyl)benzenesulfonate.
| Compound Name | potassium 2-(diphenylphosphanylmethyl)benzenesulfonate |
|---|---|
| PubChem CID | 59163443 |
| Molecular Formula | C19H16KO3PS |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | potassium 2-(diphenylphosphanylmethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccccc1CP(c1ccccc1)c1ccccc1.[K+] |
| InChI | InChI=1S/C19H17O3PS.K/c20-24(21,22)19-14-8-7-9-16(19)15-23(17-10-3-1-4-11-17)18-12-5-2-6-13-18;/h1-14H,15H2,(H,20,21,22);/q;+1/p-1 |
| InChIKey | KKGMGPFYHKHECQ-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|