C28H36P2 — CID 87241692
ditert-butyl-[[2-(diphenylphosphanylmethyl)phenyl]methyl]phosphane (PubChem CID 87241692) has the molecular formula C28H36P2 and a molecular weight of 434.54 g/mol. Its IUPAC name is ditert-butyl-[[2-(diphenylphosphanylmethyl)phenyl]methyl]phosphane.
| Compound Name | ditert-butyl-[[2-(diphenylphosphanylmethyl)phenyl]methyl]phosphane |
|---|---|
| PubChem CID | 87241692 |
| Molecular Formula | C28H36P2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | ditert-butyl-[[2-(diphenylphosphanylmethyl)phenyl]methyl]phosphane |
| SMILES | CC(C)(C)P(Cc1ccccc1CP(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H36P2/c1-27(2,3)30(28(4,5)6)22-24-16-14-13-15-23(24)21-29(25-17-9-7-10-18-25)26-19-11-8-12-20-26/h7-20H,21-22H2,1-6H3 |
| InChIKey | QJDSTDZCNSLHNR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|