C28H46P2 — CID 102468817
ditert-butyl-[[8-(ditert-butylphosphanylmethyl)naphthalen-1-yl]methyl]phosphane (PubChem CID 102468817) has the molecular formula C28H46P2 and a molecular weight of 444.62 g/mol. Its IUPAC name is ditert-butyl-[[8-(ditert-butylphosphanylmethyl)naphthalen-1-yl]methyl]phosphane.
| Compound Name | ditert-butyl-[[8-(ditert-butylphosphanylmethyl)naphthalen-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 102468817 |
| Molecular Formula | C28H46P2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | ditert-butyl-[[8-(ditert-butylphosphanylmethyl)naphthalen-1-yl]methyl]phosphane |
| SMILES | CC(C)(C)P(Cc1cccc2cccc(CP(C(C)(C)C)C(C)(C)C)c12)C(C)(C)C |
| InChI | InChI=1S/C28H46P2/c1-25(2,3)29(26(4,5)6)19-22-17-13-15-21-16-14-18-23(24(21)22)20-30(27(7,8)9)28(10,11)12/h13-18H,19-20H2,1-12H3 |
| InChIKey | PWIIYHFSTNFWED-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|