C21H27N2P — CID 122456424
ditert-butyl(1,10-phenanthrolin-2-ylmethyl)phosphane (PubChem CID 122456424) has the molecular formula C21H27N2P and a molecular weight of 338.44 g/mol. Its IUPAC name is ditert-butyl(1,10-phenanthrolin-2-ylmethyl)phosphane.
| Compound Name | ditert-butyl(1,10-phenanthrolin-2-ylmethyl)phosphane |
|---|---|
| PubChem CID | 122456424 |
| Molecular Formula | C21H27N2P |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | ditert-butyl(1,10-phenanthrolin-2-ylmethyl)phosphane |
| SMILES | CC(C)(C)P(Cc1ccc2ccc3cccnc3c2n1)C(C)(C)C |
| InChI | InChI=1S/C21H27N2P/c1-20(2,3)24(21(4,5)6)14-17-12-11-16-10-9-15-8-7-13-22-18(15)19(16)23-17/h7-13H,14H2,1-6H3 |
| InChIKey | NREBYUJQBQLNSI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|