C19H22N2 — CID 150280165
2-heptyl-1,10-phenanthroline (PubChem CID 150280165) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-heptyl-1,10-phenanthroline.
| Compound Name | 2-heptyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 150280165 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-heptyl-1,10-phenanthroline |
| SMILES | CCCCCCCc1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C19H22N2/c1-2-3-4-5-6-9-17-13-12-16-11-10-15-8-7-14-20-18(15)19(16)21-17/h7-8,10-14H,2-6,9H2,1H3 |
| InChIKey | GFKHJAFBKWVLIZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|