C25H48O3P2 — CID 173176245
ditert-butyl-[[2-(2,4,6,8-tetramethyl-1,3,5,7-trioxaphosphocan-7-yl)phenyl]methyl]phosphane;methane (PubChem CID 173176245) has the molecular formula C25H48O3P2 and a molecular weight of 458.60 g/mol. Its IUPAC name is ditert-butyl-[[2-(2,4,6,8-tetramethyl-1,3,5,7-trioxaphosphocan-7-yl)phenyl]methyl]phosphane;methane.
| Compound Name | ditert-butyl-[[2-(2,4,6,8-tetramethyl-1,3,5,7-trioxaphosphocan-7-yl)phenyl]methyl]phosphane;methane |
|---|---|
| PubChem CID | 173176245 |
| Molecular Formula | C25H48O3P2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | ditert-butyl-[[2-(2,4,6,8-tetramethyl-1,3,5,7-trioxaphosphocan-7-yl)phenyl]methyl]phosphane;methane |
| SMILES | C.C.CC1OC(C)OC(C)P(c2ccccc2CP(C(C)(C)C)C(C)(C)C)C(C)O1 |
| InChI | InChI=1S/C23H40O3P2.2CH4/c1-16-24-17(2)26-19(4)28(18(3)25-16)21-14-12-11-13-20(21)15-27(22(5,6)7)23(8,9)10;;/h11-14,16-19H,15H2,1-10H3;2*1H4 |
| InChIKey | UIDAJMUDUSHDMZ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|