C19H17O3PS — CID 59163444
2-(diphenylphosphanylmethyl)benzenesulfonic acid (PubChem CID 59163444) has the molecular formula C19H17O3PS and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-(diphenylphosphanylmethyl)benzenesulfonic acid.
| Compound Name | 2-(diphenylphosphanylmethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 59163444 |
| Molecular Formula | C19H17O3PS |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-(diphenylphosphanylmethyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17O3PS/c20-24(21,22)19-14-8-7-9-16(19)15-23(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-14H,15H2,(H,20,21,22) |
| InChIKey | SSIFUPKDGWAJCF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|