C26H24O12P2S4 — CID 19368965
2-[2-bis(2-sulfophenyl)phosphanylethyl-(2-sulfophenyl)phosphanyl]benzenesulfonic acid (PubChem CID 19368965) has the molecular formula C26H24O12P2S4 and a molecular weight of 718.68 g/mol. Its IUPAC name is 2-[2-bis(2-sulfophenyl)phosphanylethyl-(2-sulfophenyl)phosphanyl]benzenesulfonic acid.
| Compound Name | 2-[2-bis(2-sulfophenyl)phosphanylethyl-(2-sulfophenyl)phosphanyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 19368965 |
| Molecular Formula | C26H24O12P2S4 |
| Molecular Weight | 718.68 g/mol |
| Exact Mass | 717.96 |
| IUPAC Name | 2-[2-bis(2-sulfophenyl)phosphanylethyl-(2-sulfophenyl)phosphanyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1P(CCP(c1ccccc1S(=O)(=O)O)c1ccccc1S(=O)(=O)O)c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C26H24O12P2S4/c27-41(28,29)23-13-5-1-9-19(23)39(20-10-2-6-14-24(20)42(30,31)32)17-18-40(21-11-3-7-15-25(21)43(33,34)35)22-12-4-8-16-26(22)44(36,37)38/h1-16H,17-18H2,(H,27,28,29)(H,30,31,32)(H,33,34,35)(H,36,37,38) |
| InChIKey | YTBCFMAXSPQQOH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.68 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|