About 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel
2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel (PubChem CID 174928340) has the molecular formula C24H19NiO5PS2
and a molecular weight of 541.21 g/mol. Its IUPAC name is 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel.
Molecular Properties
| Compound Name | 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel |
| PubChem CID | 174928340 |
| Molecular Formula | C24H19NiO5PS2 |
| Molecular Weight | 541.21 g/mol |
| Exact Mass | 539.98 |
| IUPAC Name | 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel |
| SMILES | O=S(=O)(O)c1ccccc1P(c1ccccc1)c1ccccc1S(=O)(=O)c1ccccc1.[Ni] |
| InChI | InChI=1S/C24H19O5PS2.Ni/c25-31(26,20-13-5-2-6-14-20)23-17-9-7-15-21(23)30(19-11-3-1-4-12-19)22-16-8-10-18-24(22)32(27,28)29;/h1-18H,(H,27,28,29); |
| InChIKey | ARFVHPQJEWDJIV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel?
The IUPAC name of 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel (CID 174928340) is 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel.
What is the SMILES notation for 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel?
The canonical SMILES for 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel is O=S(=O)(O)c1ccccc1P(c1ccccc1)c1ccccc1S(=O)(=O)c1ccccc1.[Ni].
What is the InChIKey of 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel?
The InChIKey is ARFVHPQJEWDJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19O5PS2.Ni/c25-31(26,20-13-5-2-6-14-20)23-17-9-7-15-21(23)30(19-11-3-1-4-12-19)22-16-8-10-18-24(22)32(27,28)29;/h1-18H,(H,27,28,29);.
What are the key properties of 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel?
2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel has a molecular weight of 541.21 g/mol, XLogP of 3.52, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(benzenesulfonyl)phenyl]-phenylphosphanyl]benzenesulfonic acid;nickel is sourced from PubChem (CID 174928340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).