About 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid
2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid (PubChem CID 118360989) has the molecular formula C22H18N2O5S
and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid.
Molecular Properties
| Compound Name | 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid |
| PubChem CID | 118360989 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid |
| SMILES | O=C1C(Cc2ccccc2S(=O)(=O)O)C(=O)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H18N2O5S/c25-21-19(15-16-9-7-8-14-20(16)30(27,28)29)22(26)24(18-12-5-2-6-13-18)23(21)17-10-3-1-4-11-17/h1-14,19H,15H2,(H,27,28,29) |
| InChIKey | PXFOKJCHGUKCMJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid?
The IUPAC name of 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid (CID 118360989) is 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid.
What is the SMILES notation for 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid?
The canonical SMILES for 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid is O=C1C(Cc2ccccc2S(=O)(=O)O)C(=O)N(c2ccccc2)N1c1ccccc1.
What is the InChIKey of 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid?
The InChIKey is PXFOKJCHGUKCMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O5S/c25-21-19(15-16-9-7-8-14-20(16)30(27,28)29)22(26)24(18-12-5-2-6-13-18)23(21)17-10-3-1-4-11-17/h1-14,19H,15H2,(H,27,28,29).
What are the key properties of 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid?
2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid has a molecular weight of 422.46 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl]benzenesulfonic acid is sourced from PubChem (CID 118360989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).