About benzenethiol;trifluoromethanesulfonate
benzenethiol;trifluoromethanesulfonate (PubChem CID 23284292) has the molecular formula C7H6F3O3S2-
and a molecular weight of 259.25 g/mol. Its IUPAC name is benzenethiol;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | benzenethiol;trifluoromethanesulfonate |
| PubChem CID | 23284292 |
| Molecular Formula | C7H6F3O3S2- |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | benzenethiol;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.Sc1ccccc1 |
| InChI | InChI=1S/C6H6S.CHF3O3S/c7-6-4-2-1-3-5-6;2-1(3,4)8(5,6)7/h1-5,7H;(H,5,6,7)/p-1 |
| InChIKey | XWEVKPKISJJUAH-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze benzenethiol;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiol;trifluoromethanesulfonate?
The IUPAC name of benzenethiol;trifluoromethanesulfonate (CID 23284292) is benzenethiol;trifluoromethanesulfonate.
What is the SMILES notation for benzenethiol;trifluoromethanesulfonate?
The canonical SMILES for benzenethiol;trifluoromethanesulfonate is O=S(=O)([O-])C(F)(F)F.Sc1ccccc1.
What is the InChIKey of benzenethiol;trifluoromethanesulfonate?
The InChIKey is XWEVKPKISJJUAH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6S.CHF3O3S/c7-6-4-2-1-3-5-6;2-1(3,4)8(5,6)7/h1-5,7H;(H,5,6,7)/p-1.
What are the key properties of benzenethiol;trifluoromethanesulfonate?
benzenethiol;trifluoromethanesulfonate has a molecular weight of 259.25 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiol;trifluoromethanesulfonate is sourced from PubChem (CID 23284292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).