C20H15AsF6O6S2 — CID 162786650
trifluoromethanesulfonate;triphenyl(trifluoromethylsulfonyloxy)arsanium (PubChem CID 162786650) has the molecular formula C20H15AsF6O6S2 and a molecular weight of 604.38 g/mol. Its IUPAC name is trifluoromethanesulfonate;triphenyl(trifluoromethylsulfonyloxy)arsanium.
| Compound Name | trifluoromethanesulfonate;triphenyl(trifluoromethylsulfonyloxy)arsanium |
|---|---|
| PubChem CID | 162786650 |
| Molecular Formula | C20H15AsF6O6S2 |
| Molecular Weight | 604.38 g/mol |
| Exact Mass | 603.94 |
| IUPAC Name | trifluoromethanesulfonate;triphenyl(trifluoromethylsulfonyloxy)arsanium |
| SMILES | O=S(=O)(O[As+](c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H15AsF3O3S.CHF3O3S/c21-19(22,23)27(24,25)26-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7/h1-15H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | AVQZPAUNEYMDQT-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|