About CID 158705201
CID 158705201 (PubChem CID 158705201) has the molecular formula C19H15F3O5S3
and a molecular weight of 476.52 g/mol.
Molecular Properties
| Compound Name | CID 158705201 |
| PubChem CID | 158705201 |
| Molecular Formula | C19H15F3O5S3 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | — |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)=[S+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15O2S2.CHF3O3S/c19-21(20)22(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7/h1-15H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | IIAJBBAFWAHOHE-UHFFFAOYSA-M |
| XLogP | 4.16 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze CID 158705201 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158705201?
The IUPAC name of CID 158705201 (CID 158705201) is not available.
What is the SMILES notation for CID 158705201?
The canonical SMILES for CID 158705201 is O=S(=O)([O-])C(F)(F)F.O=S(=O)=[S+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 158705201?
The InChIKey is IIAJBBAFWAHOHE-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15O2S2.CHF3O3S/c19-21(20)22(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7/h1-15H;(H,5,6,7)/q+1;/p-1.
What are the key properties of CID 158705201?
CID 158705201 has a molecular weight of 476.52 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158705201 is sourced from PubChem (CID 158705201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).