C16H32F3NO3S — CID 171615814
1-octyl-2-propylpyrrolidin-1-ium;trifluoromethanesulfonate (PubChem CID 171615814) has the molecular formula C16H32F3NO3S and a molecular weight of 375.50 g/mol. Its IUPAC name is 1-octyl-2-propylpyrrolidin-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-octyl-2-propylpyrrolidin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171615814 |
| Molecular Formula | C16H32F3NO3S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 1-octyl-2-propylpyrrolidin-1-ium;trifluoromethanesulfonate |
| SMILES | CCCCCCCC[NH+]1CCCC1CCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H31N.CHF3O3S/c1-3-5-6-7-8-9-13-16-14-10-12-15(16)11-4-2;2-1(3,4)8(5,6)7/h15H,3-14H2,1-2H3;(H,5,6,7) |
| InChIKey | DQBSILQUQLGNEQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|