C18H36F3NO3S — CID 171616069
2-butyl-1-nonylpyrrolidin-1-ium;trifluoromethanesulfonate (PubChem CID 171616069) has the molecular formula C18H36F3NO3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 2-butyl-1-nonylpyrrolidin-1-ium;trifluoromethanesulfonate.
| Compound Name | 2-butyl-1-nonylpyrrolidin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171616069 |
| Molecular Formula | C18H36F3NO3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 2-butyl-1-nonylpyrrolidin-1-ium;trifluoromethanesulfonate |
| SMILES | CCCCCCCCC[NH+]1CCCC1CCCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C17H35N.CHF3O3S/c1-3-5-7-8-9-10-11-15-18-16-12-14-17(18)13-6-4-2;2-1(3,4)8(5,6)7/h17H,3-16H2,1-2H3;(H,5,6,7) |
| InChIKey | OGQCLXYGZXONNN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|