C12H24F3NO3S — CID 171616125
1,2-dipropylpiperidin-1-ium;trifluoromethanesulfonate (PubChem CID 171616125) has the molecular formula C12H24F3NO3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 1,2-dipropylpiperidin-1-ium;trifluoromethanesulfonate.
| Compound Name | 1,2-dipropylpiperidin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171616125 |
| Molecular Formula | C12H24F3NO3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1,2-dipropylpiperidin-1-ium;trifluoromethanesulfonate |
| SMILES | CCCC1CCCC[NH+]1CCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H23N.CHF3O3S/c1-3-7-11-8-5-6-10-12(11)9-4-2;2-1(3,4)8(5,6)7/h11H,3-10H2,1-2H3;(H,5,6,7) |
| InChIKey | UCPCJSUSTDLGTL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|