C9H14F6N2O4S — CID 173032743
2,2,2-trifluoro-N-(trifluoromethylsulfonyl)ethanimidate;trimethyl(oxiran-2-ylmethyl)azanium (PubChem CID 173032743) has the molecular formula C9H14F6N2O4S and a molecular weight of 360.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)ethanimidate;trimethyl(oxiran-2-ylmethyl)azanium.
| Compound Name | 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)ethanimidate;trimethyl(oxiran-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 173032743 |
| Molecular Formula | C9H14F6N2O4S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)ethanimidate;trimethyl(oxiran-2-ylmethyl)azanium |
| SMILES | C[N+](C)(C)CC1CO1.O=S(=O)(N=C([O-])C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H14NO.C3HF6NO3S/c1-7(2,3)4-6-5-8-6;4-2(5,6)1(11)10-14(12,13)3(7,8)9/h6H,4-5H2,1-3H3;(H,10,11)/q+1;/p-1 |
| InChIKey | MUKBEWXPHOHEBS-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 82.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|