C19H33F3NO3S- — CID 155621297
(E,1Z)-N-(trifluoromethylsulfonyl)octadec-9-enimidate (PubChem CID 155621297) has the molecular formula C19H33F3NO3S- and a molecular weight of 412.54 g/mol. Its IUPAC name is (E,1Z)-N-(trifluoromethylsulfonyl)octadec-9-enimidate.
| Compound Name | (E,1Z)-N-(trifluoromethylsulfonyl)octadec-9-enimidate |
|---|---|
| PubChem CID | 155621297 |
| Molecular Formula | C19H33F3NO3S- |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (E,1Z)-N-(trifluoromethylsulfonyl)octadec-9-enimidate |
| SMILES | CCCCCCCC/C=C/CCCCCCC/C([O-])=N/S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H34F3NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(24)23-27(25,26)19(20,21)22/h9-10H,2-8,11-17H2,1H3,(H,23,24)/p-1/b10-9+ |
| InChIKey | ZCTQDJIDFLBDSG-MDZDMXLPSA-M |
| XLogP | 5.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|