C21H40KNO4S — CID 101283847
potassium (E)-N-(3-sulfopropyl)octadec-9-enimidate (PubChem CID 101283847) has the molecular formula C21H40KNO4S and a molecular weight of 441.72 g/mol. Its IUPAC name is potassium (E)-N-(3-sulfopropyl)octadec-9-enimidate.
| Compound Name | potassium (E)-N-(3-sulfopropyl)octadec-9-enimidate |
|---|---|
| PubChem CID | 101283847 |
| Molecular Formula | C21H40KNO4S |
| Molecular Weight | 441.72 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | potassium (E)-N-(3-sulfopropyl)octadec-9-enimidate |
| SMILES | CCCCCCCC/C=C/CCCCCCC/C([O-])=N/CCCS(=O)(=O)O.[K+] |
| InChI | InChI=1S/C21H41NO4S.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)22-19-17-20-27(24,25)26;/h9-10H,2-8,11-20H2,1H3,(H,22,23)(H,24,25,26);/q;+1/p-1/b10-9+; |
| InChIKey | SGLRHKJFDDACQU-RRABGKBLSA-M |
| XLogP | 2.06 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|