C16H30KNO4S — CID 101283823
potassium (E)-N-(3-sulfopropyl)tridec-2-enimidate (PubChem CID 101283823) has the molecular formula C16H30KNO4S and a molecular weight of 371.58 g/mol. Its IUPAC name is potassium (E)-N-(3-sulfopropyl)tridec-2-enimidate.
| Compound Name | potassium (E)-N-(3-sulfopropyl)tridec-2-enimidate |
|---|---|
| PubChem CID | 101283823 |
| Molecular Formula | C16H30KNO4S |
| Molecular Weight | 371.58 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | potassium (E)-N-(3-sulfopropyl)tridec-2-enimidate |
| SMILES | CCCCCCCCCC/C=C/C([O-])=N/CCCS(=O)(=O)O.[K+] |
| InChI | InChI=1S/C16H31NO4S.K/c1-2-3-4-5-6-7-8-9-10-11-13-16(18)17-14-12-15-22(19,20)21;/h11,13H,2-10,12,14-15H2,1H3,(H,17,18)(H,19,20,21);/q;+1/p-1/b13-11+; |
| InChIKey | PVWDJXJQXCBNCK-BNSHTTSQSA-M |
| XLogP | 0.11 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.58 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|