C20H38NNaO5S — CID 170847700
sodium (Z)-N-(2-sulfooxyethyl)octadec-9-enimidate (PubChem CID 170847700) has the molecular formula C20H38NNaO5S and a molecular weight of 427.58 g/mol. Its IUPAC name is sodium (Z)-N-(2-sulfooxyethyl)octadec-9-enimidate.
| Compound Name | sodium (Z)-N-(2-sulfooxyethyl)octadec-9-enimidate |
|---|---|
| PubChem CID | 170847700 |
| Molecular Formula | C20H38NNaO5S |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | sodium (Z)-N-(2-sulfooxyethyl)octadec-9-enimidate |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C([O-])=N/CCOS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C20H39NO5S.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)21-18-19-26-27(23,24)25;/h9-10H,2-8,11-19H2,1H3,(H,21,22)(H,23,24,25);/q;+1/p-1/b10-9-; |
| InChIKey | GQIXRCUTKHEYQC-KVVVOXFISA-M |
| XLogP | 1.61 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|