C24H49N2O6S- — CID 170840728
(Z)-N-[2-(3-hydroxypropylamino)ethyl]octadec-9-enimidate;methyl hydrogen sulfate (PubChem CID 170840728) has the molecular formula C24H49N2O6S- and a molecular weight of 493.73 g/mol. Its IUPAC name is (Z)-N-[2-(3-hydroxypropylamino)ethyl]octadec-9-enimidate;methyl hydrogen sulfate.
| Compound Name | (Z)-N-[2-(3-hydroxypropylamino)ethyl]octadec-9-enimidate;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 170840728 |
| Molecular Formula | C24H49N2O6S- |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | (Z)-N-[2-(3-hydroxypropylamino)ethyl]octadec-9-enimidate;methyl hydrogen sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C([O-])=N/CCNCCCO.COS(=O)(=O)O |
| InChI | InChI=1S/C23H46N2O2.CH4O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-23(27)25-21-20-24-19-17-22-26;1-5-6(2,3)4/h9-10,24,26H,2-8,11-22H2,1H3,(H,25,27);1H3,(H,2,3,4)/p-1/b10-9-; |
| InChIKey | WOJFQTBHOGDZSA-KVVVOXFISA-M |
| XLogP | 4.19 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|