C42H83NO3 — CID 87840086
(Z)-docos-13-enoic acid;2-[[(Z)-octadec-9-enyl]amino]ethanol (PubChem CID 87840086) has the molecular formula C42H83NO3 and a molecular weight of 650.13 g/mol. Its IUPAC name is (Z)-docos-13-enoic acid;2-[[(Z)-octadec-9-enyl]amino]ethanol.
| Compound Name | (Z)-docos-13-enoic acid;2-[[(Z)-octadec-9-enyl]amino]ethanol |
|---|---|
| PubChem CID | 87840086 |
| Molecular Formula | C42H83NO3 |
| Molecular Weight | 650.13 g/mol |
| Exact Mass | 649.64 |
| IUPAC Name | (Z)-docos-13-enoic acid;2-[[(Z)-octadec-9-enyl]amino]ethanol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCCNCCO |
| InChI | InChI=1S/C22H42O2.C20H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-20-22/h9-10H,2-8,11-21H2,1H3,(H,23,24);9-10,21-22H,2-8,11-20H2,1H3/b2*10-9- |
| InChIKey | DOPSVNWYPIJEAG-QZOPMXJLSA-N |
| XLogP | 13.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.13 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|