C9H9F4NO7S2-2 — CID 162487835
N-[1,1,2,2-tetrafluoro-2-[(Z)-2-oxido-4-oxopent-2-en-3-yl]sulfonylethyl]sulfonylethanimidate (PubChem CID 162487835) has the molecular formula C9H9F4NO7S2-2 and a molecular weight of 383.30 g/mol. Its IUPAC name is N-[1,1,2,2-tetrafluoro-2-[(Z)-2-oxido-4-oxopent-2-en-3-yl]sulfonylethyl]sulfonylethanimidate.
| Compound Name | N-[1,1,2,2-tetrafluoro-2-[(Z)-2-oxido-4-oxopent-2-en-3-yl]sulfonylethyl]sulfonylethanimidate |
|---|---|
| PubChem CID | 162487835 |
| Molecular Formula | C9H9F4NO7S2-2 |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-[1,1,2,2-tetrafluoro-2-[(Z)-2-oxido-4-oxopent-2-en-3-yl]sulfonylethyl]sulfonylethanimidate |
| SMILES | CC(=O)/C(=C(\C)[O-])S(=O)(=O)C(F)(F)C(F)(F)S(=O)(=O)N=C(C)[O-] |
| InChI | InChI=1S/C9H11F4NO7S2/c1-4(15)7(5(2)16)22(18,19)8(10,11)9(12,13)23(20,21)14-6(3)17/h15H,1-3H3,(H,14,17)/p-2/b7-4- |
| InChIKey | JIEMIKFUWWKGDL-DAXSKMNVSA-L |
| XLogP | -1.12 |
| TPSA | 143.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|