C5H3F7NO3S- — CID 140705470
(1Z)-2,2,3,3,4,4,4-heptafluoro-N-methylsulfonylbutanimidate (PubChem CID 140705470) has the molecular formula C5H3F7NO3S- and a molecular weight of 290.14 g/mol. Its IUPAC name is (1Z)-2,2,3,3,4,4,4-heptafluoro-N-methylsulfonylbutanimidate.
| Compound Name | (1Z)-2,2,3,3,4,4,4-heptafluoro-N-methylsulfonylbutanimidate |
|---|---|
| PubChem CID | 140705470 |
| Molecular Formula | C5H3F7NO3S- |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | (1Z)-2,2,3,3,4,4,4-heptafluoro-N-methylsulfonylbutanimidate |
| SMILES | CS(=O)(=O)/N=C(\[O-])C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H4F7NO3S/c1-17(15,16)13-2(14)3(6,7)4(8,9)5(10,11)12/h1H3,(H,13,14)/p-1 |
| InChIKey | JSJBGWGKOGXEPX-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|