C5H3F8O3S- — CID 150824524
2,3,3,4,4,5,5,5-octafluoropentane-2-sulfonate (PubChem CID 150824524) has the molecular formula C5H3F8O3S- and a molecular weight of 295.13 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,5-octafluoropentane-2-sulfonate.
| Compound Name | 2,3,3,4,4,5,5,5-octafluoropentane-2-sulfonate |
|---|---|
| PubChem CID | 150824524 |
| Molecular Formula | C5H3F8O3S- |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 2,3,3,4,4,5,5,5-octafluoropentane-2-sulfonate |
| SMILES | CC(F)(C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C5H4F8O3S/c1-2(6,17(14,15)16)3(7,8)4(9,10)5(11,12)13/h1H3,(H,14,15,16)/p-1 |
| InChIKey | KKQDSOXBONFBSU-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|