C6H7F3O4S — CID 123297351
5,5,5-trifluoro-4-hydroxy-3-methylsulfonylpent-3-en-2-one (PubChem CID 123297351) has the molecular formula C6H7F3O4S and a molecular weight of 232.18 g/mol. Its IUPAC name is 5,5,5-trifluoro-4-hydroxy-3-methylsulfonylpent-3-en-2-one.
| Compound Name | 5,5,5-trifluoro-4-hydroxy-3-methylsulfonylpent-3-en-2-one |
|---|---|
| PubChem CID | 123297351 |
| Molecular Formula | C6H7F3O4S |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 5,5,5-trifluoro-4-hydroxy-3-methylsulfonylpent-3-en-2-one |
| SMILES | CC(=O)C(=C(O)C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C6H7F3O4S/c1-3(10)4(14(2,12)13)5(11)6(7,8)9/h11H,1-2H3 |
| InChIKey | BELFQIPOPHZDML-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|