C11H9F3O2 — CID 10962887
(Z)-5,5,5-trifluoro-4-hydroxy-3-phenylpent-3-en-2-one (PubChem CID 10962887) has the molecular formula C11H9F3O2 and a molecular weight of 230.19 g/mol. Its IUPAC name is (Z)-5,5,5-trifluoro-4-hydroxy-3-phenylpent-3-en-2-one.
| Compound Name | (Z)-5,5,5-trifluoro-4-hydroxy-3-phenylpent-3-en-2-one |
|---|---|
| PubChem CID | 10962887 |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (Z)-5,5,5-trifluoro-4-hydroxy-3-phenylpent-3-en-2-one |
| SMILES | CC(=O)/C(=C(\O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H9F3O2/c1-7(15)9(10(16)11(12,13)14)8-5-3-2-4-6-8/h2-6,16H,1H3/b10-9+ |
| InChIKey | XECRJWDZVLCOPU-MDZDMXLPSA-N |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|