C13H13F3O — CID 132542568
(2Z)-1,1,1-trifluoro-5-methyl-3-phenylhexa-2,4-dien-2-ol (PubChem CID 132542568) has the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. Its IUPAC name is (2Z)-1,1,1-trifluoro-5-methyl-3-phenylhexa-2,4-dien-2-ol.
| Compound Name | (2Z)-1,1,1-trifluoro-5-methyl-3-phenylhexa-2,4-dien-2-ol |
|---|---|
| PubChem CID | 132542568 |
| Molecular Formula | C13H13F3O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2Z)-1,1,1-trifluoro-5-methyl-3-phenylhexa-2,4-dien-2-ol |
| SMILES | CC(C)=C/C(=C(/O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H13F3O/c1-9(2)8-11(12(17)13(14,15)16)10-6-4-3-5-7-10/h3-8,17H,1-2H3/b12-11- |
| InChIKey | SXHJKXJGRQFNFE-QXMHVHEDSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|