C10H6F3OS- — CID 137279575
(Z)-1,1,1-trifluoro-4-oxo-3-phenylbut-2-ene-2-thiolate (PubChem CID 137279575) has the molecular formula C10H6F3OS- and a molecular weight of 231.22 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-oxo-3-phenylbut-2-ene-2-thiolate.
| Compound Name | (Z)-1,1,1-trifluoro-4-oxo-3-phenylbut-2-ene-2-thiolate |
|---|---|
| PubChem CID | 137279575 |
| Molecular Formula | C10H6F3OS- |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-oxo-3-phenylbut-2-ene-2-thiolate |
| SMILES | O=C/C(=C(\[S-])C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H7F3OS/c11-10(12,13)9(15)8(6-14)7-4-2-1-3-5-7/h1-6,15H/p-1/b9-8+ |
| InChIKey | QGDAMNVPYDUZMZ-CMDGGOBGSA-M |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|