C11H6Cl4O — CID 12619839
(2E)-3,4,5,5-tetrachloro-2-phenylpenta-2,4-dienal (PubChem CID 12619839) has the molecular formula C11H6Cl4O and a molecular weight of 295.98 g/mol. Its IUPAC name is (2E)-3,4,5,5-tetrachloro-2-phenylpenta-2,4-dienal.
| Compound Name | (2E)-3,4,5,5-tetrachloro-2-phenylpenta-2,4-dienal |
|---|---|
| PubChem CID | 12619839 |
| Molecular Formula | C11H6Cl4O |
| Molecular Weight | 295.98 g/mol |
| Exact Mass | 293.92 |
| IUPAC Name | (2E)-3,4,5,5-tetrachloro-2-phenylpenta-2,4-dienal |
| SMILES | O=C/C(=C(/Cl)C(Cl)=C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H6Cl4O/c12-9(10(13)11(14)15)8(6-16)7-4-2-1-3-5-7/h1-6H/b9-8- |
| InChIKey | BSLAJKVWSSIUKS-HJWRWDBZSA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.98 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|