C10H6Cl2F2 — CID 165354176
(1,1-dichloro-4,4-difluorobuta-1,3-dien-2-yl)benzene (PubChem CID 165354176) has the molecular formula C10H6Cl2F2 and a molecular weight of 235.06 g/mol. Its IUPAC name is (1,1-dichloro-4,4-difluorobuta-1,3-dien-2-yl)benzene.
| Compound Name | (1,1-dichloro-4,4-difluorobuta-1,3-dien-2-yl)benzene |
|---|---|
| PubChem CID | 165354176 |
| Molecular Formula | C10H6Cl2F2 |
| Molecular Weight | 235.06 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | (1,1-dichloro-4,4-difluorobuta-1,3-dien-2-yl)benzene |
| SMILES | FC(F)=CC(=C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C10H6Cl2F2/c11-10(12)8(6-9(13)14)7-4-2-1-3-5-7/h1-6H |
| InChIKey | RTQZNPKWABWNSA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.06 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|