About (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene
(1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene (PubChem CID 11770583) has the molecular formula C9H5Cl2F3
and a molecular weight of 241.04 g/mol. Its IUPAC name is (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene.
Analyze (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene?
The IUPAC name of (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene (CID 11770583) is (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene.
What is the SMILES notation for (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene?
The canonical SMILES for (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene is FC(F)(F)C(=C(Cl)Cl)c1ccccc1.
What is the InChIKey of (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene?
The InChIKey is XGJMAGKECNTHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2F3/c10-8(11)7(9(12,13)14)6-4-2-1-3-5-6/h1-5H.
What are the key properties of (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene?
(1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene has a molecular weight of 241.04 g/mol, XLogP of 4.40, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dichloro-3,3,3-trifluoroprop-1-en-2-yl)benzene is sourced from PubChem (CID 11770583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).