C16H11ClF3N — CID 177419498
(E)-3-chloro-4,4,4-trifluoro-N,2-diphenylbut-2-en-1-imine (PubChem CID 177419498) has the molecular formula C16H11ClF3N and a molecular weight of 309.72 g/mol. Its IUPAC name is (E)-3-chloro-4,4,4-trifluoro-N,2-diphenylbut-2-en-1-imine.
| Compound Name | (E)-3-chloro-4,4,4-trifluoro-N,2-diphenylbut-2-en-1-imine |
|---|---|
| PubChem CID | 177419498 |
| Molecular Formula | C16H11ClF3N |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | (E)-3-chloro-4,4,4-trifluoro-N,2-diphenylbut-2-en-1-imine |
| SMILES | FC(F)(F)/C(Cl)=C(\C=N\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H11ClF3N/c17-15(16(18,19)20)14(12-7-3-1-4-8-12)11-21-13-9-5-2-6-10-13/h1-11H/b15-14-,21-11+ |
| InChIKey | DUIIZNNJXMABAT-DYENBZIJSA-N |
| XLogP | 5.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|